About 1-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]ethanamine
1-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]ethanamine (PubChem CID 84662651) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]ethanamine.
Molecular Properties
| Compound Name | 1-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]ethanamine |
| PubChem CID | 84662651 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]ethanamine |
| SMILES | CC(N)c1cccc(C2=NCCO2)c1 |
| InChI | InChI=1S/C11H14N2O/c1-8(12)9-3-2-4-10(7-9)11-13-5-6-14-11/h2-4,7-8H,5-6,12H2,1H3 |
| InChIKey | QYVRBQLBRQNJJC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]ethanamine?
The IUPAC name of 1-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]ethanamine (CID 84662651) is 1-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]ethanamine.
What is the SMILES notation for 1-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]ethanamine?
The canonical SMILES for 1-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]ethanamine is CC(N)c1cccc(C2=NCCO2)c1.
What is the InChIKey of 1-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]ethanamine?
The InChIKey is QYVRBQLBRQNJJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-8(12)9-3-2-4-10(7-9)11-13-5-6-14-11/h2-4,7-8H,5-6,12H2,1H3.
What are the key properties of 1-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]ethanamine?
1-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]ethanamine has a molecular weight of 190.25 g/mol, XLogP of 1.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]ethanamine is sourced from PubChem (CID 84662651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).