About 6-amino-2-cyclopropyl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol
6-amino-2-cyclopropyl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol (PubChem CID 84662664) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 6-amino-2-cyclopropyl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol.
Molecular Properties
| Compound Name | 6-amino-2-cyclopropyl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol |
| PubChem CID | 84662664 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 6-amino-2-cyclopropyl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol |
| SMILES | NC1Cc2nc(C3CC3)ccc2C1O |
| InChI | InChI=1S/C11H14N2O/c12-8-5-10-7(11(8)14)3-4-9(13-10)6-1-2-6/h3-4,6,8,11,14H,1-2,5,12H2 |
| InChIKey | OYGWFQSYDDOEQU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-2-cyclopropyl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-cyclopropyl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol?
The IUPAC name of 6-amino-2-cyclopropyl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol (CID 84662664) is 6-amino-2-cyclopropyl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol.
What is the SMILES notation for 6-amino-2-cyclopropyl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol?
The canonical SMILES for 6-amino-2-cyclopropyl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol is NC1Cc2nc(C3CC3)ccc2C1O.
What is the InChIKey of 6-amino-2-cyclopropyl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol?
The InChIKey is OYGWFQSYDDOEQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c12-8-5-10-7(11(8)14)3-4-9(13-10)6-1-2-6/h3-4,6,8,11,14H,1-2,5,12H2.
What are the key properties of 6-amino-2-cyclopropyl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol?
6-amino-2-cyclopropyl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol has a molecular weight of 190.25 g/mol, XLogP of 0.88, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-cyclopropyl-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol is sourced from PubChem (CID 84662664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).