About 3-(aminomethyl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridin-4-amine
3-(aminomethyl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 84662739) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-(aminomethyl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridin-4-amine.
Molecular Properties
| Compound Name | 3-(aminomethyl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridin-4-amine |
| PubChem CID | 84662739 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 3-(aminomethyl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | CN(C)c1ccnc2[nH]cc(CN)c12 |
| InChI | InChI=1S/C10H14N4/c1-14(2)8-3-4-12-10-9(8)7(5-11)6-13-10/h3-4,6H,5,11H2,1-2H3,(H,12,13) |
| InChIKey | WBAIWTWEAHGLFK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(aminomethyl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridin-4-amine?
The IUPAC name of 3-(aminomethyl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridin-4-amine (CID 84662739) is 3-(aminomethyl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridin-4-amine.
What is the SMILES notation for 3-(aminomethyl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridin-4-amine?
The canonical SMILES for 3-(aminomethyl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridin-4-amine is CN(C)c1ccnc2[nH]cc(CN)c12.
What is the InChIKey of 3-(aminomethyl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridin-4-amine?
The InChIKey is WBAIWTWEAHGLFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-14(2)8-3-4-12-10-9(8)7(5-11)6-13-10/h3-4,6H,5,11H2,1-2H3,(H,12,13).
What are the key properties of 3-(aminomethyl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridin-4-amine?
3-(aminomethyl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridin-4-amine has a molecular weight of 190.25 g/mol, XLogP of 1.09, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-N,N-dimethyl-1H-pyrrolo[2,3-b]pyridin-4-amine is sourced from PubChem (CID 84662739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).