About N'-methyl-N'-(1H-pyrrolo[2,3-b]pyridin-4-yl)ethane-1,2-diamine
N'-methyl-N'-(1H-pyrrolo[2,3-b]pyridin-4-yl)ethane-1,2-diamine (PubChem CID 84662769) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is N'-methyl-N'-(1H-pyrrolo[2,3-b]pyridin-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-methyl-N'-(1H-pyrrolo[2,3-b]pyridin-4-yl)ethane-1,2-diamine |
| PubChem CID | 84662769 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | N'-methyl-N'-(1H-pyrrolo[2,3-b]pyridin-4-yl)ethane-1,2-diamine |
| SMILES | CN(CCN)c1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C10H14N4/c1-14(7-4-11)9-3-6-13-10-8(9)2-5-12-10/h2-3,5-6H,4,7,11H2,1H3,(H,12,13) |
| InChIKey | NJRFWUDLMWQEBI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-methyl-N'-(1H-pyrrolo[2,3-b]pyridin-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-(1H-pyrrolo[2,3-b]pyridin-4-yl)ethane-1,2-diamine?
The IUPAC name of N'-methyl-N'-(1H-pyrrolo[2,3-b]pyridin-4-yl)ethane-1,2-diamine (CID 84662769) is N'-methyl-N'-(1H-pyrrolo[2,3-b]pyridin-4-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-methyl-N'-(1H-pyrrolo[2,3-b]pyridin-4-yl)ethane-1,2-diamine?
The canonical SMILES for N'-methyl-N'-(1H-pyrrolo[2,3-b]pyridin-4-yl)ethane-1,2-diamine is CN(CCN)c1ccnc2[nH]ccc12.
What is the InChIKey of N'-methyl-N'-(1H-pyrrolo[2,3-b]pyridin-4-yl)ethane-1,2-diamine?
The InChIKey is NJRFWUDLMWQEBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-14(7-4-11)9-3-6-13-10-8(9)2-5-12-10/h2-3,5-6H,4,7,11H2,1H3,(H,12,13).
What are the key properties of N'-methyl-N'-(1H-pyrrolo[2,3-b]pyridin-4-yl)ethane-1,2-diamine?
N'-methyl-N'-(1H-pyrrolo[2,3-b]pyridin-4-yl)ethane-1,2-diamine has a molecular weight of 190.25 g/mol, XLogP of 0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-(1H-pyrrolo[2,3-b]pyridin-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 84662769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).