About 3-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]propan-1-amine
3-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]propan-1-amine (PubChem CID 84662890) has the molecular formula C7H14N2S2
and a molecular weight of 190.34 g/mol. Its IUPAC name is 3-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]propan-1-amine |
| PubChem CID | 84662890 |
| Molecular Formula | C7H14N2S2 |
| Molecular Weight | 190.34 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 3-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]propan-1-amine |
| SMILES | CC1CSC(SCCCN)=N1 |
| InChI | InChI=1S/C7H14N2S2/c1-6-5-11-7(9-6)10-4-2-3-8/h6H,2-5,8H2,1H3 |
| InChIKey | ZXTIPXYDYQJVLG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]propan-1-amine?
The IUPAC name of 3-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]propan-1-amine (CID 84662890) is 3-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]propan-1-amine.
What is the SMILES notation for 3-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]propan-1-amine?
The canonical SMILES for 3-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]propan-1-amine is CC1CSC(SCCCN)=N1.
What is the InChIKey of 3-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]propan-1-amine?
The InChIKey is ZXTIPXYDYQJVLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2S2/c1-6-5-11-7(9-6)10-4-2-3-8/h6H,2-5,8H2,1H3.
What are the key properties of 3-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]propan-1-amine?
3-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]propan-1-amine has a molecular weight of 190.34 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methyl-4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]propan-1-amine is sourced from PubChem (CID 84662890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).