7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid

C11H13NO2 — CID 84663204

IUPAC7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid
SMILESCC1CCc2c(N)cc(C(=O)O)cc21
InChIInChI=1S/C11H13NO2/c1-6-2-3-8-9(6)4-7(11(13)14)5-10(8)12/h4-6H,2-3,12H2,1H3,(H,13,14)
InChIKeyIXHLBLYXOBBWRB-UHFFFAOYSA-N
MW191.23 g/mol
LogP2.02
Rot. Bonds1

About 7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid

7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid (PubChem CID 84663204) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid.

Molecular Properties

Compound Name7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid
PubChem CID84663204
Molecular FormulaC11H13NO2
Molecular Weight191.23 g/mol
Exact Mass191.09
IUPAC Name7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid
SMILESCC1CCc2c(N)cc(C(=O)O)cc21
InChIInChI=1S/C11H13NO2/c1-6-2-3-8-9(6)4-7(11(13)14)5-10(8)12/h4-6H,2-3,12H2,1H3,(H,13,14)
InChIKeyIXHLBLYXOBBWRB-UHFFFAOYSA-N
XLogP2.02
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.23
LogP ≤ 52.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid?
The IUPAC name of 7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid (CID 84663204) is 7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid.
What is the SMILES notation for 7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid?
The canonical SMILES for 7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid is CC1CCc2c(N)cc(C(=O)O)cc21.
What is the InChIKey of 7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid?
The InChIKey is IXHLBLYXOBBWRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-6-2-3-8-9(6)4-7(11(13)14)5-10(8)12/h4-6H,2-3,12H2,1H3,(H,13,14).
What are the key properties of 7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid?
7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid has a molecular weight of 191.23 g/mol, XLogP of 2.02, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-3-methyl-2,3-dihydro-1H-indene-5-carboxylic acid is sourced from PubChem (CID 84663204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).