About 3-N-propan-2-yl-1,2-benzoxazole-3,4-diamine
3-N-propan-2-yl-1,2-benzoxazole-3,4-diamine (PubChem CID 84663359) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-N-propan-2-yl-1,2-benzoxazole-3,4-diamine.
Molecular Properties
| Compound Name | 3-N-propan-2-yl-1,2-benzoxazole-3,4-diamine |
| PubChem CID | 84663359 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 3-N-propan-2-yl-1,2-benzoxazole-3,4-diamine |
| SMILES | CC(C)Nc1noc2cccc(N)c12 |
| InChI | InChI=1S/C10H13N3O/c1-6(2)12-10-9-7(11)4-3-5-8(9)14-13-10/h3-6H,11H2,1-2H3,(H,12,13) |
| InChIKey | OURKURAJZPSAML-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-N-propan-2-yl-1,2-benzoxazole-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-propan-2-yl-1,2-benzoxazole-3,4-diamine?
The IUPAC name of 3-N-propan-2-yl-1,2-benzoxazole-3,4-diamine (CID 84663359) is 3-N-propan-2-yl-1,2-benzoxazole-3,4-diamine.
What is the SMILES notation for 3-N-propan-2-yl-1,2-benzoxazole-3,4-diamine?
The canonical SMILES for 3-N-propan-2-yl-1,2-benzoxazole-3,4-diamine is CC(C)Nc1noc2cccc(N)c12.
What is the InChIKey of 3-N-propan-2-yl-1,2-benzoxazole-3,4-diamine?
The InChIKey is OURKURAJZPSAML-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-6(2)12-10-9-7(11)4-3-5-8(9)14-13-10/h3-6H,11H2,1-2H3,(H,12,13).
What are the key properties of 3-N-propan-2-yl-1,2-benzoxazole-3,4-diamine?
3-N-propan-2-yl-1,2-benzoxazole-3,4-diamine has a molecular weight of 191.23 g/mol, XLogP of 2.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-propan-2-yl-1,2-benzoxazole-3,4-diamine is sourced from PubChem (CID 84663359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).