6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid

C10H12N2O2 — CID 84663896

IUPAC6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid
SMILESCN1CCc2c(C(=O)O)cc(N)cc21
InChIInChI=1S/C10H12N2O2/c1-12-3-2-7-8(10(13)14)4-6(11)5-9(7)12/h4-5H,2-3,11H2,1H3,(H,13,14)
InChIKeyKBXCNBMUWTWUCY-UHFFFAOYSA-N
MW192.22 g/mol
LogP0.96
Rot. Bonds1

About 6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid

6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid (PubChem CID 84663896) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid.

Molecular Properties

Compound Name6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid
PubChem CID84663896
Molecular FormulaC10H12N2O2
Molecular Weight192.22 g/mol
Exact Mass192.09
IUPAC Name6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid
SMILESCN1CCc2c(C(=O)O)cc(N)cc21
InChIInChI=1S/C10H12N2O2/c1-12-3-2-7-8(10(13)14)4-6(11)5-9(7)12/h4-5H,2-3,11H2,1H3,(H,13,14)
InChIKeyKBXCNBMUWTWUCY-UHFFFAOYSA-N
XLogP0.96
TPSA66.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.22
LogP ≤ 50.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid?
The IUPAC name of 6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid (CID 84663896) is 6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid.
What is the SMILES notation for 6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid?
The canonical SMILES for 6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid is CN1CCc2c(C(=O)O)cc(N)cc21.
What is the InChIKey of 6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid?
The InChIKey is KBXCNBMUWTWUCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-12-3-2-7-8(10(13)14)4-6(11)5-9(7)12/h4-5H,2-3,11H2,1H3,(H,13,14).
What are the key properties of 6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid?
6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid has a molecular weight of 192.22 g/mol, XLogP of 0.96, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1-methyl-2,3-dihydroindole-4-carboxylic acid is sourced from PubChem (CID 84663896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).