C5H5ClN2O2S — CID 84664406
2-amino-2-(4-chloro-1,2-thiazol-5-yl)acetic acid (PubChem CID 84664406) has the molecular formula C5H5ClN2O2S and a molecular weight of 192.63 g/mol. Its IUPAC name is 2-amino-2-(4-chloro-1,2-thiazol-5-yl)acetic acid.
| Compound Name | 2-amino-2-(4-chloro-1,2-thiazol-5-yl)acetic acid |
|---|---|
| PubChem CID | 84664406 |
| Molecular Formula | C5H5ClN2O2S |
| Molecular Weight | 192.63 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | 2-amino-2-(4-chloro-1,2-thiazol-5-yl)acetic acid |
| SMILES | NC(C(=O)O)c1sncc1Cl |
| InChI | InChI=1S/C5H5ClN2O2S/c6-2-1-8-11-4(2)3(7)5(9)10/h1,3H,7H2,(H,9,10) |
| InChIKey | RSKSOWCNFWZDSF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.63 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |