About 2-amino-1-(4-chloro-1,2-thiazol-5-yl)propan-1-ol
2-amino-1-(4-chloro-1,2-thiazol-5-yl)propan-1-ol (PubChem CID 84664427) has the molecular formula C6H9ClN2OS
and a molecular weight of 192.67 g/mol. Its IUPAC name is 2-amino-1-(4-chloro-1,2-thiazol-5-yl)propan-1-ol.
Molecular Properties
| Compound Name | 2-amino-1-(4-chloro-1,2-thiazol-5-yl)propan-1-ol |
| PubChem CID | 84664427 |
| Molecular Formula | C6H9ClN2OS |
| Molecular Weight | 192.67 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | 2-amino-1-(4-chloro-1,2-thiazol-5-yl)propan-1-ol |
| SMILES | CC(N)C(O)c1sncc1Cl |
| InChI | InChI=1S/C6H9ClN2OS/c1-3(8)5(10)6-4(7)2-9-11-6/h2-3,5,10H,8H2,1H3 |
| InChIKey | PEOGIQLYWZEIJK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.67 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-(4-chloro-1,2-thiazol-5-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(4-chloro-1,2-thiazol-5-yl)propan-1-ol?
The IUPAC name of 2-amino-1-(4-chloro-1,2-thiazol-5-yl)propan-1-ol (CID 84664427) is 2-amino-1-(4-chloro-1,2-thiazol-5-yl)propan-1-ol.
What is the SMILES notation for 2-amino-1-(4-chloro-1,2-thiazol-5-yl)propan-1-ol?
The canonical SMILES for 2-amino-1-(4-chloro-1,2-thiazol-5-yl)propan-1-ol is CC(N)C(O)c1sncc1Cl.
What is the InChIKey of 2-amino-1-(4-chloro-1,2-thiazol-5-yl)propan-1-ol?
The InChIKey is PEOGIQLYWZEIJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN2OS/c1-3(8)5(10)6-4(7)2-9-11-6/h2-3,5,10H,8H2,1H3.
What are the key properties of 2-amino-1-(4-chloro-1,2-thiazol-5-yl)propan-1-ol?
2-amino-1-(4-chloro-1,2-thiazol-5-yl)propan-1-ol has a molecular weight of 192.67 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(4-chloro-1,2-thiazol-5-yl)propan-1-ol is sourced from PubChem (CID 84664427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).