About 5-methoxyimidazo[1,2-a]pyrimidine-7-carboxylic acid
5-methoxyimidazo[1,2-a]pyrimidine-7-carboxylic acid (PubChem CID 84664482) has the molecular formula C8H7N3O3
and a molecular weight of 193.16 g/mol. Its IUPAC name is 5-methoxyimidazo[1,2-a]pyrimidine-7-carboxylic acid.
Molecular Properties
| Compound Name | 5-methoxyimidazo[1,2-a]pyrimidine-7-carboxylic acid |
| PubChem CID | 84664482 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 5-methoxyimidazo[1,2-a]pyrimidine-7-carboxylic acid |
| SMILES | COc1cc(C(=O)O)nc2nccn12 |
| InChI | InChI=1S/C8H7N3O3/c1-14-6-4-5(7(12)13)10-8-9-2-3-11(6)8/h2-4H,1H3,(H,12,13) |
| InChIKey | XFHKYCOASCANOC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxyimidazo[1,2-a]pyrimidine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxyimidazo[1,2-a]pyrimidine-7-carboxylic acid?
The IUPAC name of 5-methoxyimidazo[1,2-a]pyrimidine-7-carboxylic acid (CID 84664482) is 5-methoxyimidazo[1,2-a]pyrimidine-7-carboxylic acid.
What is the SMILES notation for 5-methoxyimidazo[1,2-a]pyrimidine-7-carboxylic acid?
The canonical SMILES for 5-methoxyimidazo[1,2-a]pyrimidine-7-carboxylic acid is COc1cc(C(=O)O)nc2nccn12.
What is the InChIKey of 5-methoxyimidazo[1,2-a]pyrimidine-7-carboxylic acid?
The InChIKey is XFHKYCOASCANOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O3/c1-14-6-4-5(7(12)13)10-8-9-2-3-11(6)8/h2-4H,1H3,(H,12,13).
What are the key properties of 5-methoxyimidazo[1,2-a]pyrimidine-7-carboxylic acid?
5-methoxyimidazo[1,2-a]pyrimidine-7-carboxylic acid has a molecular weight of 193.16 g/mol, XLogP of 0.44, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxyimidazo[1,2-a]pyrimidine-7-carboxylic acid is sourced from PubChem (CID 84664482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).