3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid

C11H15NO2 — CID 84664754

IUPAC3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid
SMILESCc1ccc(CC(C)C(=O)O)nc1C
InChIInChI=1S/C11H15NO2/c1-7-4-5-10(12-9(7)3)6-8(2)11(13)14/h4-5,8H,6H2,1-3H3,(H,13,14)
InChIKeyJPAXWFJOOQONCJ-UHFFFAOYSA-N
MW193.25 g/mol
LogP1.96
Rot. Bonds3

About 3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid

3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid (PubChem CID 84664754) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid.

Molecular Properties

Compound Name3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid
PubChem CID84664754
Molecular FormulaC11H15NO2
Molecular Weight193.25 g/mol
Exact Mass193.11
IUPAC Name3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid
SMILESCc1ccc(CC(C)C(=O)O)nc1C
InChIInChI=1S/C11H15NO2/c1-7-4-5-10(12-9(7)3)6-8(2)11(13)14/h4-5,8H,6H2,1-3H3,(H,13,14)
InChIKeyJPAXWFJOOQONCJ-UHFFFAOYSA-N
XLogP1.96
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.25
LogP ≤ 51.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-(7-fluoroquinolin-2-yl)-2-methylpropanoic acid
CID 82243062
3-(7-bromoquinolin-2-yl)-2-methylpropanoic acid
CID 82251244
3-(8-fluoroquinolin-2-yl)-2-methylpropanoic acid
CID 82243060
3-(6-chloroquinolin-2-yl)-2-methylpropanoic acid
CID 82244797
3-(6,8-difluoroquinolin-2-yl)-2-methylpropanoic acid
CID 82244963
3-[6-(dimethylamino)-2-pyridinyl]-2-methylpropanoic acid
CID 83883833
(2R)-3-(3,4-dimethylphenyl)-2-methylpropanoic acid
CID 94240670
(2R)-2-methyl-3-quinoxalin-2-ylpropanoic acid
CID 124512095
3-(5-bromo-4-methyl-2-pyridinyl)-2-methylpropanoic acid
CID 83901573
2-methyl-3-(4-methylpyrimidin-2-yl)propanoic acid
CID 116900020
2-methyl-3-(3-methyl-4-pyridinyl)propanoic acid
CID 115008773
3-(3-ethyl-4-methylphenyl)-2-methylpropanoic acid
CID 84674441

Frequently Asked Questions

What is the IUPAC name of 3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid?
The IUPAC name of 3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid (CID 84664754) is 3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid.
What is the SMILES notation for 3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid?
The canonical SMILES for 3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid is Cc1ccc(CC(C)C(=O)O)nc1C.
What is the InChIKey of 3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid?
The InChIKey is JPAXWFJOOQONCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-7-4-5-10(12-9(7)3)6-8(2)11(13)14/h4-5,8H,6H2,1-3H3,(H,13,14).
What are the key properties of 3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid?
3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid has a molecular weight of 193.25 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,6-dimethyl-2-pyridinyl)-2-methylpropanoic acid is sourced from PubChem (CID 84664754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).