C8H10N4S — CID 84665579
6-(aminomethyl)-3-methyl-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 84665579) has the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. Its IUPAC name is 6-(aminomethyl)-3-methyl-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 6-(aminomethyl)-3-methyl-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 84665579 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 6-(aminomethyl)-3-methyl-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | Cn1c(=S)[nH]c2cc(CN)cnc21 |
| InChI | InChI=1S/C8H10N4S/c1-12-7-6(11-8(12)13)2-5(3-9)4-10-7/h2,4H,3,9H2,1H3,(H,11,13) |
| InChIKey | VFQKCSSCDRFEND-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|