C11H18N2O — CID 84665659
5-ethyl-2-(piperidin-3-ylmethyl)-1,3-oxazole (PubChem CID 84665659) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 5-ethyl-2-(piperidin-3-ylmethyl)-1,3-oxazole.
| Compound Name | 5-ethyl-2-(piperidin-3-ylmethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 84665659 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 5-ethyl-2-(piperidin-3-ylmethyl)-1,3-oxazole |
| SMILES | CCc1cnc(CC2CCCNC2)o1 |
| InChI | InChI=1S/C11H18N2O/c1-2-10-8-13-11(14-10)6-9-4-3-5-12-7-9/h8-9,12H,2-7H2,1H3 |
| InChIKey | NHHOTBXHTFOGSQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |