About 2-(1,1-difluoroethyl)-1-benzofuran-6-ol
2-(1,1-difluoroethyl)-1-benzofuran-6-ol (PubChem CID 84668031) has the molecular formula C10H8F2O2
and a molecular weight of 198.17 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-1-benzofuran-6-ol.
Molecular Properties
| Compound Name | 2-(1,1-difluoroethyl)-1-benzofuran-6-ol |
| PubChem CID | 84668031 |
| Molecular Formula | C10H8F2O2 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2-(1,1-difluoroethyl)-1-benzofuran-6-ol |
| SMILES | CC(F)(F)c1cc2ccc(O)cc2o1 |
| InChI | InChI=1S/C10H8F2O2/c1-10(11,12)9-4-6-2-3-7(13)5-8(6)14-9/h2-5,13H,1H3 |
| InChIKey | DMFOSHIEQATMHH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1,1-difluoroethyl)-1-benzofuran-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-difluoroethyl)-1-benzofuran-6-ol?
The IUPAC name of 2-(1,1-difluoroethyl)-1-benzofuran-6-ol (CID 84668031) is 2-(1,1-difluoroethyl)-1-benzofuran-6-ol.
What is the SMILES notation for 2-(1,1-difluoroethyl)-1-benzofuran-6-ol?
The canonical SMILES for 2-(1,1-difluoroethyl)-1-benzofuran-6-ol is CC(F)(F)c1cc2ccc(O)cc2o1.
What is the InChIKey of 2-(1,1-difluoroethyl)-1-benzofuran-6-ol?
The InChIKey is DMFOSHIEQATMHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2O2/c1-10(11,12)9-4-6-2-3-7(13)5-8(6)14-9/h2-5,13H,1H3.
What are the key properties of 2-(1,1-difluoroethyl)-1-benzofuran-6-ol?
2-(1,1-difluoroethyl)-1-benzofuran-6-ol has a molecular weight of 198.17 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-difluoroethyl)-1-benzofuran-6-ol is sourced from PubChem (CID 84668031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).