1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid

C8H10N2O2S — CID 84668330

IUPAC1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid
SMILESO=C(O)c1cnn(CC2CSC2)c1
InChIInChI=1S/C8H10N2O2S/c11-8(12)7-1-9-10(3-7)2-6-4-13-5-6/h1,3,6H,2,4-5H2,(H,11,12)
InChIKeyNSEBQPHUFNALCB-UHFFFAOYSA-N
MW198.25 g/mol
LogP0.94
Rot. Bonds3

About 1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid

1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid (PubChem CID 84668330) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is 1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid.

Molecular Properties

Compound Name1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid
PubChem CID84668330
Molecular FormulaC8H10N2O2S
Molecular Weight198.25 g/mol
Exact Mass198.05
IUPAC Name1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid
SMILESO=C(O)c1cnn(CC2CSC2)c1
InChIInChI=1S/C8H10N2O2S/c11-8(12)7-1-9-10(3-7)2-6-4-13-5-6/h1,3,6H,2,4-5H2,(H,11,12)
InChIKeyNSEBQPHUFNALCB-UHFFFAOYSA-N
XLogP0.94
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.25
LogP ≤ 50.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1-[[1-[2-(dimethylamino)acetyl]piperidin-4-yl]methyl]pyrazole-4-carboxylic acid
CID 95826382
1-[[1-(2-methoxyacetyl)piperidin-4-yl]methyl]pyrazole-4-carboxylic acid
CID 95826381
4-[1-(cyclopropylmethyl)pyrazol-4-yl]benzoic acid
CID 122555883
1-[1-(cyclopropylmethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone
CID 63755688
4-[[1-(cyclopropylmethyl)pyrazole-4-carbonyl]amino]benzoic acid
CID 146136886
1-(2-bicyclo[2.2.1]heptanylmethyl)pyrazole-4-carboxylic acid
CID 79552080
1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]pyrazole-4-carboxylic acid
CID 43565318
1-[1-(cyclopentylmethyl)pyrazol-4-yl]ethanone
CID 62727814
6-[1-(cyclopropylmethyl)pyrazol-4-yl]naphthalene-2-carboxylic acid
CID 172868753
1-(1-oxaspiro[4.4]nonan-2-ylmethyl)pyrazole-4-carboxylic acid
CID 102898692
5-[1-(cyclopropylmethyl)pyrazol-4-yl]thiophene-3-carboxylic acid
CID 170456840
1-(cyanomethyl)pyrazole-4-carboxylic acid
CID 43565339

Frequently Asked Questions

What is the IUPAC name of 1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid?
The IUPAC name of 1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid (CID 84668330) is 1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid.
What is the SMILES notation for 1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid?
The canonical SMILES for 1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid is O=C(O)c1cnn(CC2CSC2)c1.
What is the InChIKey of 1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid?
The InChIKey is NSEBQPHUFNALCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2S/c11-8(12)7-1-9-10(3-7)2-6-4-13-5-6/h1,3,6H,2,4-5H2,(H,11,12).
What are the key properties of 1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid?
1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid has a molecular weight of 198.25 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(thietan-3-ylmethyl)pyrazole-4-carboxylic acid is sourced from PubChem (CID 84668330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).