C10H11ClO2 — CID 84668554
3-chloro-5,6,7,8-tetrahydronaphthalene-1,2-diol (PubChem CID 84668554) has the molecular formula C10H11ClO2 and a molecular weight of 198.65 g/mol. Its IUPAC name is 3-chloro-5,6,7,8-tetrahydronaphthalene-1,2-diol.
| Compound Name | 3-chloro-5,6,7,8-tetrahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 84668554 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 3-chloro-5,6,7,8-tetrahydronaphthalene-1,2-diol |
| SMILES | Oc1c(Cl)cc2c(c1O)CCCC2 |
| InChI | InChI=1S/C10H11ClO2/c11-8-5-6-3-1-2-4-7(6)9(12)10(8)13/h5,12-13H,1-4H2 |
| InChIKey | OMWRBIPPTCFLNI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|