About 4-bromo-[1,3]oxazolo[5,4-c]pyridine
4-bromo-[1,3]oxazolo[5,4-c]pyridine (PubChem CID 84668628) has the molecular formula C6H3BrN2O
and a molecular weight of 199.01 g/mol. Its IUPAC name is 4-bromo-[1,3]oxazolo[5,4-c]pyridine.
Molecular Properties
| Compound Name | 4-bromo-[1,3]oxazolo[5,4-c]pyridine |
| PubChem CID | 84668628 |
| Molecular Formula | C6H3BrN2O |
| Molecular Weight | 199.01 g/mol |
| Exact Mass | 197.94 |
| IUPAC Name | 4-bromo-[1,3]oxazolo[5,4-c]pyridine |
| SMILES | Brc1nccc2ncoc12 |
| InChI | InChI=1S/C6H3BrN2O/c7-6-5-4(1-2-8-6)9-3-10-5/h1-3H |
| InChIKey | RSGXZRXAZSNKFT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.01 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-[1,3]oxazolo[5,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-[1,3]oxazolo[5,4-c]pyridine?
The IUPAC name of 4-bromo-[1,3]oxazolo[5,4-c]pyridine (CID 84668628) is 4-bromo-[1,3]oxazolo[5,4-c]pyridine.
What is the SMILES notation for 4-bromo-[1,3]oxazolo[5,4-c]pyridine?
The canonical SMILES for 4-bromo-[1,3]oxazolo[5,4-c]pyridine is Brc1nccc2ncoc12.
What is the InChIKey of 4-bromo-[1,3]oxazolo[5,4-c]pyridine?
The InChIKey is RSGXZRXAZSNKFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrN2O/c7-6-5-4(1-2-8-6)9-3-10-5/h1-3H.
What are the key properties of 4-bromo-[1,3]oxazolo[5,4-c]pyridine?
4-bromo-[1,3]oxazolo[5,4-c]pyridine has a molecular weight of 199.01 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-[1,3]oxazolo[5,4-c]pyridine is sourced from PubChem (CID 84668628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).