C13H29N — CID 84669079
N-tert-butyl-2,2,4,4-tetramethylpentan-3-amine (PubChem CID 84669079) has the molecular formula C13H29N and a molecular weight of 199.38 g/mol. Its IUPAC name is N-tert-butyl-2,2,4,4-tetramethylpentan-3-amine.
| Compound Name | N-tert-butyl-2,2,4,4-tetramethylpentan-3-amine |
|---|---|
| PubChem CID | 84669079 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | N-tert-butyl-2,2,4,4-tetramethylpentan-3-amine |
| SMILES | CC(C)(C)NC(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H29N/c1-11(2,3)10(12(4,5)6)14-13(7,8)9/h10,14H,1-9H3 |
| InChIKey | XMTCSEFTINODEM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |