C8H12ClN3O — CID 84670367
2-chloro-5-(piperidin-2-ylmethyl)-1,3,4-oxadiazole (PubChem CID 84670367) has the molecular formula C8H12ClN3O and a molecular weight of 201.66 g/mol. Its IUPAC name is 2-chloro-5-(piperidin-2-ylmethyl)-1,3,4-oxadiazole.
| Compound Name | 2-chloro-5-(piperidin-2-ylmethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 84670367 |
| Molecular Formula | C8H12ClN3O |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 2-chloro-5-(piperidin-2-ylmethyl)-1,3,4-oxadiazole |
| SMILES | Clc1nnc(CC2CCCCN2)o1 |
| InChI | InChI=1S/C8H12ClN3O/c9-8-12-11-7(13-8)5-6-3-1-2-4-10-6/h6,10H,1-5H2 |
| InChIKey | OWNWYLYAMZCSFD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |