About 3-bromo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine
3-bromo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine (PubChem CID 84670419) has the molecular formula C6H8BrN3
and a molecular weight of 202.05 g/mol. Its IUPAC name is 3-bromo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine.
Analyze 3-bromo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine?
The IUPAC name of 3-bromo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine (CID 84670419) is 3-bromo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine.
What is the SMILES notation for 3-bromo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine?
The canonical SMILES for 3-bromo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine is Brc1nnn2c1CCCC2.
What is the InChIKey of 3-bromo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine?
The InChIKey is VCYBJKWLKBRWKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrN3/c7-6-5-3-1-2-4-10(5)9-8-6/h1-4H2.
What are the key properties of 3-bromo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine?
3-bromo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine has a molecular weight of 202.05 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine is sourced from PubChem (CID 84670419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).