C9H8F2O3 — CID 84670427
3-fluoro-5-(fluoromethyl)-2-methoxybenzoic acid (PubChem CID 84670427) has the molecular formula C9H8F2O3 and a molecular weight of 202.16 g/mol. Its IUPAC name is 3-fluoro-5-(fluoromethyl)-2-methoxybenzoic acid.
| Compound Name | 3-fluoro-5-(fluoromethyl)-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 84670427 |
| Molecular Formula | C9H8F2O3 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 3-fluoro-5-(fluoromethyl)-2-methoxybenzoic acid |
| SMILES | COc1c(F)cc(CF)cc1C(=O)O |
| InChI | InChI=1S/C9H8F2O3/c1-14-8-6(9(12)13)2-5(4-10)3-7(8)11/h2-3H,4H2,1H3,(H,12,13) |
| InChIKey | OPLSIWBVSJUEIS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |