About 7-(cyclopropylamino)-[1,3]oxazolo[5,4-b]pyridine-2-carbaldehyde
7-(cyclopropylamino)-[1,3]oxazolo[5,4-b]pyridine-2-carbaldehyde (PubChem CID 84671363) has the molecular formula C10H9N3O2
and a molecular weight of 203.20 g/mol. Its IUPAC name is 7-(cyclopropylamino)-[1,3]oxazolo[5,4-b]pyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | 7-(cyclopropylamino)-[1,3]oxazolo[5,4-b]pyridine-2-carbaldehyde |
| PubChem CID | 84671363 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 7-(cyclopropylamino)-[1,3]oxazolo[5,4-b]pyridine-2-carbaldehyde |
| SMILES | O=Cc1nc2c(NC3CC3)ccnc2o1 |
| InChI | InChI=1S/C10H9N3O2/c14-5-8-13-9-7(12-6-1-2-6)3-4-11-10(9)15-8/h3-6H,1-2H2,(H,11,12) |
| InChIKey | GIGIPZAXWOLROH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-(cyclopropylamino)-[1,3]oxazolo[5,4-b]pyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(cyclopropylamino)-[1,3]oxazolo[5,4-b]pyridine-2-carbaldehyde?
The IUPAC name of 7-(cyclopropylamino)-[1,3]oxazolo[5,4-b]pyridine-2-carbaldehyde (CID 84671363) is 7-(cyclopropylamino)-[1,3]oxazolo[5,4-b]pyridine-2-carbaldehyde.
What is the SMILES notation for 7-(cyclopropylamino)-[1,3]oxazolo[5,4-b]pyridine-2-carbaldehyde?
The canonical SMILES for 7-(cyclopropylamino)-[1,3]oxazolo[5,4-b]pyridine-2-carbaldehyde is O=Cc1nc2c(NC3CC3)ccnc2o1.
What is the InChIKey of 7-(cyclopropylamino)-[1,3]oxazolo[5,4-b]pyridine-2-carbaldehyde?
The InChIKey is GIGIPZAXWOLROH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2/c14-5-8-13-9-7(12-6-1-2-6)3-4-11-10(9)15-8/h3-6H,1-2H2,(H,11,12).
What are the key properties of 7-(cyclopropylamino)-[1,3]oxazolo[5,4-b]pyridine-2-carbaldehyde?
7-(cyclopropylamino)-[1,3]oxazolo[5,4-b]pyridine-2-carbaldehyde has a molecular weight of 203.20 g/mol, XLogP of 1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(cyclopropylamino)-[1,3]oxazolo[5,4-b]pyridine-2-carbaldehyde is sourced from PubChem (CID 84671363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).