About 1-(2-cyclopropyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanol
1-(2-cyclopropyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanol (PubChem CID 84672283) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 1-(2-cyclopropyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanol.
Molecular Properties
| Compound Name | 1-(2-cyclopropyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanol |
| PubChem CID | 84672283 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 1-(2-cyclopropyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanol |
| SMILES | CC(O)c1cnc2oc(C3CC3)nc2c1 |
| InChI | InChI=1S/C11H12N2O2/c1-6(14)8-4-9-11(12-5-8)15-10(13-9)7-2-3-7/h4-7,14H,2-3H2,1H3 |
| InChIKey | JWGOWNKGUNYJQM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-cyclopropyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclopropyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanol?
The IUPAC name of 1-(2-cyclopropyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanol (CID 84672283) is 1-(2-cyclopropyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanol.
What is the SMILES notation for 1-(2-cyclopropyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanol?
The canonical SMILES for 1-(2-cyclopropyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanol is CC(O)c1cnc2oc(C3CC3)nc2c1.
What is the InChIKey of 1-(2-cyclopropyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanol?
The InChIKey is JWGOWNKGUNYJQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-6(14)8-4-9-11(12-5-8)15-10(13-9)7-2-3-7/h4-7,14H,2-3H2,1H3.
What are the key properties of 1-(2-cyclopropyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanol?
1-(2-cyclopropyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanol has a molecular weight of 204.23 g/mol, XLogP of 2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclopropyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanol is sourced from PubChem (CID 84672283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).