About 2-amino-1-pyrido[3,4-b]pyrazin-3-ylpropan-1-ol
2-amino-1-pyrido[3,4-b]pyrazin-3-ylpropan-1-ol (PubChem CID 84672357) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-amino-1-pyrido[3,4-b]pyrazin-3-ylpropan-1-ol.
Molecular Properties
| Compound Name | 2-amino-1-pyrido[3,4-b]pyrazin-3-ylpropan-1-ol |
| PubChem CID | 84672357 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-amino-1-pyrido[3,4-b]pyrazin-3-ylpropan-1-ol |
| SMILES | CC(N)C(O)c1cnc2ccncc2n1 |
| InChI | InChI=1S/C10H12N4O/c1-6(11)10(15)9-5-13-7-2-3-12-4-8(7)14-9/h2-6,10,15H,11H2,1H3 |
| InChIKey | FPQNODNQTNTNOI-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-1-pyrido[3,4-b]pyrazin-3-ylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-pyrido[3,4-b]pyrazin-3-ylpropan-1-ol?
The IUPAC name of 2-amino-1-pyrido[3,4-b]pyrazin-3-ylpropan-1-ol (CID 84672357) is 2-amino-1-pyrido[3,4-b]pyrazin-3-ylpropan-1-ol.
What is the SMILES notation for 2-amino-1-pyrido[3,4-b]pyrazin-3-ylpropan-1-ol?
The canonical SMILES for 2-amino-1-pyrido[3,4-b]pyrazin-3-ylpropan-1-ol is CC(N)C(O)c1cnc2ccncc2n1.
What is the InChIKey of 2-amino-1-pyrido[3,4-b]pyrazin-3-ylpropan-1-ol?
The InChIKey is FPQNODNQTNTNOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-6(11)10(15)9-5-13-7-2-3-12-4-8(7)14-9/h2-6,10,15H,11H2,1H3.
What are the key properties of 2-amino-1-pyrido[3,4-b]pyrazin-3-ylpropan-1-ol?
2-amino-1-pyrido[3,4-b]pyrazin-3-ylpropan-1-ol has a molecular weight of 204.23 g/mol, XLogP of 0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-pyrido[3,4-b]pyrazin-3-ylpropan-1-ol is sourced from PubChem (CID 84672357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).