About 2-[5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethanamine
2-[5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethanamine (PubChem CID 84672465) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-[5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethanamine |
| PubChem CID | 84672465 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-[5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethanamine |
| SMILES | Cc1ccc(C2CN=C(CCN)O2)cc1 |
| InChI | InChI=1S/C12H16N2O/c1-9-2-4-10(5-3-9)11-8-14-12(15-11)6-7-13/h2-5,11H,6-8,13H2,1H3 |
| InChIKey | DPUUFYGLJZMFFG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethanamine?
The IUPAC name of 2-[5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethanamine (CID 84672465) is 2-[5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethanamine.
What is the SMILES notation for 2-[5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethanamine?
The canonical SMILES for 2-[5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethanamine is Cc1ccc(C2CN=C(CCN)O2)cc1.
What is the InChIKey of 2-[5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethanamine?
The InChIKey is DPUUFYGLJZMFFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-9-2-4-10(5-3-9)11-8-14-12(15-11)6-7-13/h2-5,11H,6-8,13H2,1H3.
What are the key properties of 2-[5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethanamine?
2-[5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethanamine has a molecular weight of 204.27 g/mol, XLogP of 1.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]ethanamine is sourced from PubChem (CID 84672465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).