About 4-amino-3-(2-chloro-1,3-oxazol-5-yl)butanoic acid
4-amino-3-(2-chloro-1,3-oxazol-5-yl)butanoic acid (PubChem CID 84672745) has the molecular formula C7H9ClN2O3
and a molecular weight of 204.61 g/mol. Its IUPAC name is 4-amino-3-(2-chloro-1,3-oxazol-5-yl)butanoic acid.
Molecular Properties
| Compound Name | 4-amino-3-(2-chloro-1,3-oxazol-5-yl)butanoic acid |
| PubChem CID | 84672745 |
| Molecular Formula | C7H9ClN2O3 |
| Molecular Weight | 204.61 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 4-amino-3-(2-chloro-1,3-oxazol-5-yl)butanoic acid |
| SMILES | NCC(CC(=O)O)c1cnc(Cl)o1 |
| InChI | InChI=1S/C7H9ClN2O3/c8-7-10-3-5(13-7)4(2-9)1-6(11)12/h3-4H,1-2,9H2,(H,11,12) |
| InChIKey | MEMPQAPRVMEBKQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.61 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-3-(2-chloro-1,3-oxazol-5-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-(2-chloro-1,3-oxazol-5-yl)butanoic acid?
The IUPAC name of 4-amino-3-(2-chloro-1,3-oxazol-5-yl)butanoic acid (CID 84672745) is 4-amino-3-(2-chloro-1,3-oxazol-5-yl)butanoic acid.
What is the SMILES notation for 4-amino-3-(2-chloro-1,3-oxazol-5-yl)butanoic acid?
The canonical SMILES for 4-amino-3-(2-chloro-1,3-oxazol-5-yl)butanoic acid is NCC(CC(=O)O)c1cnc(Cl)o1.
What is the InChIKey of 4-amino-3-(2-chloro-1,3-oxazol-5-yl)butanoic acid?
The InChIKey is MEMPQAPRVMEBKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O3/c8-7-10-3-5(13-7)4(2-9)1-6(11)12/h3-4H,1-2,9H2,(H,11,12).
What are the key properties of 4-amino-3-(2-chloro-1,3-oxazol-5-yl)butanoic acid?
4-amino-3-(2-chloro-1,3-oxazol-5-yl)butanoic acid has a molecular weight of 204.61 g/mol, XLogP of 0.85, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(2-chloro-1,3-oxazol-5-yl)butanoic acid is sourced from PubChem (CID 84672745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).