C11H16N2O2 — CID 84676139
2,3-dimethoxy-4-pyrrolidin-3-ylpyridine (PubChem CID 84676139) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2,3-dimethoxy-4-pyrrolidin-3-ylpyridine.
| Compound Name | 2,3-dimethoxy-4-pyrrolidin-3-ylpyridine |
|---|---|
| PubChem CID | 84676139 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2,3-dimethoxy-4-pyrrolidin-3-ylpyridine |
| SMILES | COc1nccc(C2CCNC2)c1OC |
| InChI | InChI=1S/C11H16N2O2/c1-14-10-9(8-3-5-12-7-8)4-6-13-11(10)15-2/h4,6,8,12H,3,5,7H2,1-2H3 |
| InChIKey | OIEZPTBADXUDGF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |