C11H20N4 — CID 84676351
4-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]azepane (PubChem CID 84676351) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]azepane.
| Compound Name | 4-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]azepane |
|---|---|
| PubChem CID | 84676351 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 4-[(2,5-dimethyl-1,2,4-triazol-3-yl)methyl]azepane |
| SMILES | Cc1nc(CC2CCCNCC2)n(C)n1 |
| InChI | InChI=1S/C11H20N4/c1-9-13-11(15(2)14-9)8-10-4-3-6-12-7-5-10/h10,12H,3-8H2,1-2H3 |
| InChIKey | ZCRHMPDBYSSZKF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |