2-ethyl-3,6-dimethoxybenzoic acid

C11H14O4 — CID 84677566

IUPAC2-ethyl-3,6-dimethoxybenzoic acid
SMILESCCc1c(OC)ccc(OC)c1C(=O)O
InChIInChI=1S/C11H14O4/c1-4-7-8(14-2)5-6-9(15-3)10(7)11(12)13/h5-6H,4H2,1-3H3,(H,12,13)
InChIKeyYQNCPFREDUFDDZ-UHFFFAOYSA-N
MW210.23 g/mol
LogP1.96
Rot. Bonds4

About 2-ethyl-3,6-dimethoxybenzoic acid

2-ethyl-3,6-dimethoxybenzoic acid (PubChem CID 84677566) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-ethyl-3,6-dimethoxybenzoic acid.

Molecular Properties

Compound Name2-ethyl-3,6-dimethoxybenzoic acid
PubChem CID84677566
Molecular FormulaC11H14O4
Molecular Weight210.23 g/mol
Exact Mass210.09
IUPAC Name2-ethyl-3,6-dimethoxybenzoic acid
SMILESCCc1c(OC)ccc(OC)c1C(=O)O
InChIInChI=1S/C11H14O4/c1-4-7-8(14-2)5-6-9(15-3)10(7)11(12)13/h5-6H,4H2,1-3H3,(H,12,13)
InChIKeyYQNCPFREDUFDDZ-UHFFFAOYSA-N
XLogP1.96
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 51.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-ethyl-3,6-dimethoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-3,6-dimethoxybenzoic acid?
The IUPAC name of 2-ethyl-3,6-dimethoxybenzoic acid (CID 84677566) is 2-ethyl-3,6-dimethoxybenzoic acid.
What is the SMILES notation for 2-ethyl-3,6-dimethoxybenzoic acid?
The canonical SMILES for 2-ethyl-3,6-dimethoxybenzoic acid is CCc1c(OC)ccc(OC)c1C(=O)O.
What is the InChIKey of 2-ethyl-3,6-dimethoxybenzoic acid?
The InChIKey is YQNCPFREDUFDDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-4-7-8(14-2)5-6-9(15-3)10(7)11(12)13/h5-6H,4H2,1-3H3,(H,12,13).
What are the key properties of 2-ethyl-3,6-dimethoxybenzoic acid?
2-ethyl-3,6-dimethoxybenzoic acid has a molecular weight of 210.23 g/mol, XLogP of 1.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3,6-dimethoxybenzoic acid is sourced from PubChem (CID 84677566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).