About 2-(1,1-difluoroethyl)-6-ethyl-2,3-dihydro-1H-indole
2-(1,1-difluoroethyl)-6-ethyl-2,3-dihydro-1H-indole (PubChem CID 84678421) has the molecular formula C12H15F2N
and a molecular weight of 211.25 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-6-ethyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 2-(1,1-difluoroethyl)-6-ethyl-2,3-dihydro-1H-indole |
| PubChem CID | 84678421 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-(1,1-difluoroethyl)-6-ethyl-2,3-dihydro-1H-indole |
| SMILES | CCc1ccc2c(c1)NC(C(C)(F)F)C2 |
| InChI | InChI=1S/C12H15F2N/c1-3-8-4-5-9-7-11(12(2,13)14)15-10(9)6-8/h4-6,11,15H,3,7H2,1-2H3 |
| InChIKey | KIIOEDOIVUGROQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(1,1-difluoroethyl)-6-ethyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-difluoroethyl)-6-ethyl-2,3-dihydro-1H-indole?
The IUPAC name of 2-(1,1-difluoroethyl)-6-ethyl-2,3-dihydro-1H-indole (CID 84678421) is 2-(1,1-difluoroethyl)-6-ethyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 2-(1,1-difluoroethyl)-6-ethyl-2,3-dihydro-1H-indole?
The canonical SMILES for 2-(1,1-difluoroethyl)-6-ethyl-2,3-dihydro-1H-indole is CCc1ccc2c(c1)NC(C(C)(F)F)C2.
What is the InChIKey of 2-(1,1-difluoroethyl)-6-ethyl-2,3-dihydro-1H-indole?
The InChIKey is KIIOEDOIVUGROQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2N/c1-3-8-4-5-9-7-11(12(2,13)14)15-10(9)6-8/h4-6,11,15H,3,7H2,1-2H3.
What are the key properties of 2-(1,1-difluoroethyl)-6-ethyl-2,3-dihydro-1H-indole?
2-(1,1-difluoroethyl)-6-ethyl-2,3-dihydro-1H-indole has a molecular weight of 211.25 g/mol, XLogP of 3.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-difluoroethyl)-6-ethyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 84678421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).