C11H14ClNO — CID 84678817
6-chloro-1-ethyl-1,2,3,4-tetrahydroisoquinolin-5-ol (PubChem CID 84678817) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 6-chloro-1-ethyl-1,2,3,4-tetrahydroisoquinolin-5-ol.
| Compound Name | 6-chloro-1-ethyl-1,2,3,4-tetrahydroisoquinolin-5-ol |
|---|---|
| PubChem CID | 84678817 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 6-chloro-1-ethyl-1,2,3,4-tetrahydroisoquinolin-5-ol |
| SMILES | CCC1NCCc2c1ccc(Cl)c2O |
| InChI | InChI=1S/C11H14ClNO/c1-2-10-7-3-4-9(12)11(14)8(7)5-6-13-10/h3-4,10,13-14H,2,5-6H2,1H3 |
| InChIKey | SFMVXTUWFSRKOA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |