2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid

C5H3Cl2NO2S — CID 84678868

IUPAC2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid
SMILESO=C(O)Cc1nc(Cl)sc1Cl
InChIInChI=1S/C5H3Cl2NO2S/c6-4-2(1-3(9)10)8-5(7)11-4/h1H2,(H,9,10)
InChIKeyMZKBSIOEYNFNMB-UHFFFAOYSA-N
MW212.06 g/mol
LogP2.08
Rot. Bonds2

About 2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid

2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid (PubChem CID 84678868) has the molecular formula C5H3Cl2NO2S and a molecular weight of 212.06 g/mol. Its IUPAC name is 2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid
PubChem CID84678868
Molecular FormulaC5H3Cl2NO2S
Molecular Weight212.06 g/mol
Exact Mass210.93
IUPAC Name2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid
SMILESO=C(O)Cc1nc(Cl)sc1Cl
InChIInChI=1S/C5H3Cl2NO2S/c6-4-2(1-3(9)10)8-5(7)11-4/h1H2,(H,9,10)
InChIKeyMZKBSIOEYNFNMB-UHFFFAOYSA-N
XLogP2.08
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.06
LogP ≤ 52.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid?
The IUPAC name of 2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid (CID 84678868) is 2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid.
What is the SMILES notation for 2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid?
The canonical SMILES for 2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid is O=C(O)Cc1nc(Cl)sc1Cl.
What is the InChIKey of 2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid?
The InChIKey is MZKBSIOEYNFNMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3Cl2NO2S/c6-4-2(1-3(9)10)8-5(7)11-4/h1H2,(H,9,10).
What are the key properties of 2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid?
2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid has a molecular weight of 212.06 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dichloro-1,3-thiazol-4-yl)acetic acid is sourced from PubChem (CID 84678868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).