C10H12ClNO2 — CID 84679932
2-(4-chloro-6-methyl-1,3-benzodioxol-5-yl)ethanamine (PubChem CID 84679932) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is 2-(4-chloro-6-methyl-1,3-benzodioxol-5-yl)ethanamine.
| Compound Name | 2-(4-chloro-6-methyl-1,3-benzodioxol-5-yl)ethanamine |
|---|---|
| PubChem CID | 84679932 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-(4-chloro-6-methyl-1,3-benzodioxol-5-yl)ethanamine |
| SMILES | Cc1cc2c(c(Cl)c1CCN)OCO2 |
| InChI | InChI=1S/C10H12ClNO2/c1-6-4-8-10(14-5-13-8)9(11)7(6)2-3-12/h4H,2-3,5,12H2,1H3 |
| InChIKey | ARFSSRQRSJKZED-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |