C8H10N2O3S — CID 84680344
5-[(methylcarbamoylamino)methyl]thiophene-2-carboxylic acid (PubChem CID 84680344) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is 5-[(methylcarbamoylamino)methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(methylcarbamoylamino)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 84680344 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 5-[(methylcarbamoylamino)methyl]thiophene-2-carboxylic acid |
| SMILES | CNC(=O)NCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C8H10N2O3S/c1-9-8(13)10-4-5-2-3-6(14-5)7(11)12/h2-3H,4H2,1H3,(H,11,12)(H2,9,10,13) |
| InChIKey | DDFDZDPZDVSQGN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |