C10H11F2NO2 — CID 84680878
4-(3,3-difluoropropylamino)benzoic acid (PubChem CID 84680878) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is 4-(3,3-difluoropropylamino)benzoic acid.
| Compound Name | 4-(3,3-difluoropropylamino)benzoic acid |
|---|---|
| PubChem CID | 84680878 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 4-(3,3-difluoropropylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NCCC(F)F)cc1 |
| InChI | InChI=1S/C10H11F2NO2/c11-9(12)5-6-13-8-3-1-7(2-4-8)10(14)15/h1-4,9,13H,5-6H2,(H,14,15) |
| InChIKey | VYZOAHCMKIGGGH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |