About 2-(1-cyclopropylpyrrolo[2,3-b]pyridin-3-yl)acetic acid
2-(1-cyclopropylpyrrolo[2,3-b]pyridin-3-yl)acetic acid (PubChem CID 84681720) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-(1-cyclopropylpyrrolo[2,3-b]pyridin-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(1-cyclopropylpyrrolo[2,3-b]pyridin-3-yl)acetic acid |
| PubChem CID | 84681720 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-(1-cyclopropylpyrrolo[2,3-b]pyridin-3-yl)acetic acid |
| SMILES | O=C(O)Cc1cn(C2CC2)c2ncccc12 |
| InChI | InChI=1S/C12H12N2O2/c15-11(16)6-8-7-14(9-3-4-9)12-10(8)2-1-5-13-12/h1-2,5,7,9H,3-4,6H2,(H,15,16) |
| InChIKey | JEJRAHGIUZEQOK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-cyclopropylpyrrolo[2,3-b]pyridin-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclopropylpyrrolo[2,3-b]pyridin-3-yl)acetic acid?
The IUPAC name of 2-(1-cyclopropylpyrrolo[2,3-b]pyridin-3-yl)acetic acid (CID 84681720) is 2-(1-cyclopropylpyrrolo[2,3-b]pyridin-3-yl)acetic acid.
What is the SMILES notation for 2-(1-cyclopropylpyrrolo[2,3-b]pyridin-3-yl)acetic acid?
The canonical SMILES for 2-(1-cyclopropylpyrrolo[2,3-b]pyridin-3-yl)acetic acid is O=C(O)Cc1cn(C2CC2)c2ncccc12.
What is the InChIKey of 2-(1-cyclopropylpyrrolo[2,3-b]pyridin-3-yl)acetic acid?
The InChIKey is JEJRAHGIUZEQOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c15-11(16)6-8-7-14(9-3-4-9)12-10(8)2-1-5-13-12/h1-2,5,7,9H,3-4,6H2,(H,15,16).
What are the key properties of 2-(1-cyclopropylpyrrolo[2,3-b]pyridin-3-yl)acetic acid?
2-(1-cyclopropylpyrrolo[2,3-b]pyridin-3-yl)acetic acid has a molecular weight of 216.24 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclopropylpyrrolo[2,3-b]pyridin-3-yl)acetic acid is sourced from PubChem (CID 84681720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).