C11H15N5 — CID 84682986
2-methyl-4-piperazin-1-yl-5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 84682986) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 2-methyl-4-piperazin-1-yl-5H-pyrrolo[3,2-d]pyrimidine.
| Compound Name | 2-methyl-4-piperazin-1-yl-5H-pyrrolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 84682986 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-methyl-4-piperazin-1-yl-5H-pyrrolo[3,2-d]pyrimidine |
| SMILES | Cc1nc(N2CCNCC2)c2[nH]ccc2n1 |
| InChI | InChI=1S/C11H15N5/c1-8-14-9-2-3-13-10(9)11(15-8)16-6-4-12-5-7-16/h2-3,12-13H,4-7H2,1H3 |
| InChIKey | LPINNZJHGLNTLQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |