C11H10N2OS — CID 84683840
2-amino-5-(2-methylphenyl)-1,3-thiazole-4-carbaldehyde (PubChem CID 84683840) has the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. Its IUPAC name is 2-amino-5-(2-methylphenyl)-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-amino-5-(2-methylphenyl)-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 84683840 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 2-amino-5-(2-methylphenyl)-1,3-thiazole-4-carbaldehyde |
| SMILES | Cc1ccccc1-c1sc(N)nc1C=O |
| InChI | InChI=1S/C11H10N2OS/c1-7-4-2-3-5-8(7)10-9(6-14)13-11(12)15-10/h2-6H,1H3,(H2,12,13) |
| InChIKey | MFKSHVYFCAFCKI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|