C13H18N2O — CID 84683949
6-pyrrolidin-3-yloxy-1,2,3,4-tetrahydroquinoline (PubChem CID 84683949) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 6-pyrrolidin-3-yloxy-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-pyrrolidin-3-yloxy-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 84683949 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 6-pyrrolidin-3-yloxy-1,2,3,4-tetrahydroquinoline |
| SMILES | c1cc2c(cc1OC1CCNC1)CCCN2 |
| InChI | InChI=1S/C13H18N2O/c1-2-10-8-11(3-4-13(10)15-6-1)16-12-5-7-14-9-12/h3-4,8,12,14-15H,1-2,5-7,9H2 |
| InChIKey | BOTRVUPNSJSZLN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|