About 3-amino-2-(2,4,5-trifluorophenyl)propanoic acid
3-amino-2-(2,4,5-trifluorophenyl)propanoic acid (PubChem CID 84684316) has the molecular formula C9H8F3NO2
and a molecular weight of 219.16 g/mol. Its IUPAC name is 3-amino-2-(2,4,5-trifluorophenyl)propanoic acid.
Molecular Properties
| Compound Name | 3-amino-2-(2,4,5-trifluorophenyl)propanoic acid |
| PubChem CID | 84684316 |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 3-amino-2-(2,4,5-trifluorophenyl)propanoic acid |
| SMILES | NCC(C(=O)O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C9H8F3NO2/c10-6-2-8(12)7(11)1-4(6)5(3-13)9(14)15/h1-2,5H,3,13H2,(H,14,15) |
| InChIKey | LGPGWCWIHWJNJR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-(2,4,5-trifluorophenyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(2,4,5-trifluorophenyl)propanoic acid?
The IUPAC name of 3-amino-2-(2,4,5-trifluorophenyl)propanoic acid (CID 84684316) is 3-amino-2-(2,4,5-trifluorophenyl)propanoic acid.
What is the SMILES notation for 3-amino-2-(2,4,5-trifluorophenyl)propanoic acid?
The canonical SMILES for 3-amino-2-(2,4,5-trifluorophenyl)propanoic acid is NCC(C(=O)O)c1cc(F)c(F)cc1F.
What is the InChIKey of 3-amino-2-(2,4,5-trifluorophenyl)propanoic acid?
The InChIKey is LGPGWCWIHWJNJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3NO2/c10-6-2-8(12)7(11)1-4(6)5(3-13)9(14)15/h1-2,5H,3,13H2,(H,14,15).
What are the key properties of 3-amino-2-(2,4,5-trifluorophenyl)propanoic acid?
3-amino-2-(2,4,5-trifluorophenyl)propanoic acid has a molecular weight of 219.16 g/mol, XLogP of 1.23, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(2,4,5-trifluorophenyl)propanoic acid is sourced from PubChem (CID 84684316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).