About 2-(trifluoromethyl)-1,3-benzothiazol-5-ol
2-(trifluoromethyl)-1,3-benzothiazol-5-ol (PubChem CID 84684346) has the molecular formula C8H4F3NOS
and a molecular weight of 219.19 g/mol. Its IUPAC name is 2-(trifluoromethyl)-1,3-benzothiazol-5-ol.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)-1,3-benzothiazol-5-ol |
| PubChem CID | 84684346 |
| Molecular Formula | C8H4F3NOS |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | 2-(trifluoromethyl)-1,3-benzothiazol-5-ol |
| SMILES | Oc1ccc2sc(C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C8H4F3NOS/c9-8(10,11)7-12-5-3-4(13)1-2-6(5)14-7/h1-3,13H |
| InChIKey | MTWQQLHSPYATOX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(trifluoromethyl)-1,3-benzothiazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)-1,3-benzothiazol-5-ol?
The IUPAC name of 2-(trifluoromethyl)-1,3-benzothiazol-5-ol (CID 84684346) is 2-(trifluoromethyl)-1,3-benzothiazol-5-ol.
What is the SMILES notation for 2-(trifluoromethyl)-1,3-benzothiazol-5-ol?
The canonical SMILES for 2-(trifluoromethyl)-1,3-benzothiazol-5-ol is Oc1ccc2sc(C(F)(F)F)nc2c1.
What is the InChIKey of 2-(trifluoromethyl)-1,3-benzothiazol-5-ol?
The InChIKey is MTWQQLHSPYATOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F3NOS/c9-8(10,11)7-12-5-3-4(13)1-2-6(5)14-7/h1-3,13H.
What are the key properties of 2-(trifluoromethyl)-1,3-benzothiazol-5-ol?
2-(trifluoromethyl)-1,3-benzothiazol-5-ol has a molecular weight of 219.19 g/mol, XLogP of 3.02, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)-1,3-benzothiazol-5-ol is sourced from PubChem (CID 84684346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).