About methyl 2-amino-5,5-dioxo-5λ6-thiaspiro[2.4]heptane-2-carboxylate
methyl 2-amino-5,5-dioxo-5λ6-thiaspiro[2.4]heptane-2-carboxylate (PubChem CID 84684680) has the molecular formula C8H13NO4S
and a molecular weight of 219.26 g/mol. Its IUPAC name is methyl 2-amino-5,5-dioxo-5λ6-thiaspiro[2.4]heptane-2-carboxylate.
Molecular Properties
| Compound Name | methyl 2-amino-5,5-dioxo-5λ6-thiaspiro[2.4]heptane-2-carboxylate |
| PubChem CID | 84684680 |
| Molecular Formula | C8H13NO4S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | methyl 2-amino-5,5-dioxo-5λ6-thiaspiro[2.4]heptane-2-carboxylate |
| SMILES | COC(=O)C1(N)CC12CCS(=O)(=O)C2 |
| InChI | InChI=1S/C8H13NO4S/c1-13-6(10)8(9)4-7(8)2-3-14(11,12)5-7/h2-5,9H2,1H3 |
| InChIKey | NWSPCBODYSOQBT-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-amino-5,5-dioxo-5λ6-thiaspiro[2.4]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-5,5-dioxo-5λ6-thiaspiro[2.4]heptane-2-carboxylate?
The IUPAC name of methyl 2-amino-5,5-dioxo-5λ6-thiaspiro[2.4]heptane-2-carboxylate (CID 84684680) is methyl 2-amino-5,5-dioxo-5λ6-thiaspiro[2.4]heptane-2-carboxylate.
What is the SMILES notation for methyl 2-amino-5,5-dioxo-5λ6-thiaspiro[2.4]heptane-2-carboxylate?
The canonical SMILES for methyl 2-amino-5,5-dioxo-5λ6-thiaspiro[2.4]heptane-2-carboxylate is COC(=O)C1(N)CC12CCS(=O)(=O)C2.
What is the InChIKey of methyl 2-amino-5,5-dioxo-5λ6-thiaspiro[2.4]heptane-2-carboxylate?
The InChIKey is NWSPCBODYSOQBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO4S/c1-13-6(10)8(9)4-7(8)2-3-14(11,12)5-7/h2-5,9H2,1H3.
What are the key properties of methyl 2-amino-5,5-dioxo-5λ6-thiaspiro[2.4]heptane-2-carboxylate?
methyl 2-amino-5,5-dioxo-5λ6-thiaspiro[2.4]heptane-2-carboxylate has a molecular weight of 219.26 g/mol, XLogP of -0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-5,5-dioxo-5λ6-thiaspiro[2.4]heptane-2-carboxylate is sourced from PubChem (CID 84684680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).