C12H18N2O2 — CID 84687734
1,2-dimethyl-3-(pyrrolidin-3-ylmethoxy)pyridin-4-one (PubChem CID 84687734) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 1,2-dimethyl-3-(pyrrolidin-3-ylmethoxy)pyridin-4-one.
| Compound Name | 1,2-dimethyl-3-(pyrrolidin-3-ylmethoxy)pyridin-4-one |
|---|---|
| PubChem CID | 84687734 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1,2-dimethyl-3-(pyrrolidin-3-ylmethoxy)pyridin-4-one |
| SMILES | Cc1c(OCC2CCNC2)c(=O)ccn1C |
| InChI | InChI=1S/C12H18N2O2/c1-9-12(11(15)4-6-14(9)2)16-8-10-3-5-13-7-10/h4,6,10,13H,3,5,7-8H2,1-2H3 |
| InChIKey | TUNQSRJGCHOJQH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |