3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid

C11H11FO4 — CID 84690366

IUPAC3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid
SMILESCC(F)C1COc2ccc(C(=O)O)cc2O1
InChIInChI=1S/C11H11FO4/c1-6(12)10-5-15-8-3-2-7(11(13)14)4-9(8)16-10/h2-4,6,10H,5H2,1H3,(H,13,14)
InChIKeyLQUNNKSOVDAORA-UHFFFAOYSA-N
MW226.20 g/mol
LogP1.88
Rot. Bonds2

About 3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid

3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid (PubChem CID 84690366) has the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. Its IUPAC name is 3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid.

Molecular Properties

Compound Name3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid
PubChem CID84690366
Molecular FormulaC11H11FO4
Molecular Weight226.20 g/mol
Exact Mass226.06
IUPAC Name3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid
SMILESCC(F)C1COc2ccc(C(=O)O)cc2O1
InChIInChI=1S/C11H11FO4/c1-6(12)10-5-15-8-3-2-7(11(13)14)4-9(8)16-10/h2-4,6,10H,5H2,1H3,(H,13,14)
InChIKeyLQUNNKSOVDAORA-UHFFFAOYSA-N
XLogP1.88
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.20
LogP ≤ 51.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid?
The IUPAC name of 3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid (CID 84690366) is 3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid.
What is the SMILES notation for 3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid?
The canonical SMILES for 3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid is CC(F)C1COc2ccc(C(=O)O)cc2O1.
What is the InChIKey of 3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid?
The InChIKey is LQUNNKSOVDAORA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FO4/c1-6(12)10-5-15-8-3-2-7(11(13)14)4-9(8)16-10/h2-4,6,10H,5H2,1H3,(H,13,14).
What are the key properties of 3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid?
3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid has a molecular weight of 226.20 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-fluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid is sourced from PubChem (CID 84690366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).