About 2-amino-2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)acetic acid
2-amino-2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)acetic acid (PubChem CID 84690684) has the molecular formula C8H7ClN4O2
and a molecular weight of 226.62 g/mol. Its IUPAC name is 2-amino-2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-amino-2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)acetic acid |
| PubChem CID | 84690684 |
| Molecular Formula | C8H7ClN4O2 |
| Molecular Weight | 226.62 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 2-amino-2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)acetic acid |
| SMILES | NC(C(=O)O)c1cnc2cnc(Cl)cn12 |
| InChI | InChI=1S/C8H7ClN4O2/c9-5-3-13-4(7(10)8(14)15)1-12-6(13)2-11-5/h1-3,7H,10H2,(H,14,15) |
| InChIKey | PYPDGTWSCSTTFK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.62 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)acetic acid?
The IUPAC name of 2-amino-2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)acetic acid (CID 84690684) is 2-amino-2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)acetic acid.
What is the SMILES notation for 2-amino-2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)acetic acid?
The canonical SMILES for 2-amino-2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)acetic acid is NC(C(=O)O)c1cnc2cnc(Cl)cn12.
What is the InChIKey of 2-amino-2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)acetic acid?
The InChIKey is PYPDGTWSCSTTFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN4O2/c9-5-3-13-4(7(10)8(14)15)1-12-6(13)2-11-5/h1-3,7H,10H2,(H,14,15).
What are the key properties of 2-amino-2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)acetic acid?
2-amino-2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)acetic acid has a molecular weight of 226.62 g/mol, XLogP of 0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)acetic acid is sourced from PubChem (CID 84690684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).