C11H17NO4 — CID 84691194
tert-butyl N-(3,5-dioxocyclohexyl)carbamate (PubChem CID 84691194) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is tert-butyl N-(3,5-dioxocyclohexyl)carbamate.
| Compound Name | tert-butyl N-(3,5-dioxocyclohexyl)carbamate |
|---|---|
| PubChem CID | 84691194 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | tert-butyl N-(3,5-dioxocyclohexyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(=O)CC(=O)C1 |
| InChI | InChI=1S/C11H17NO4/c1-11(2,3)16-10(15)12-7-4-8(13)6-9(14)5-7/h7H,4-6H2,1-3H3,(H,12,15) |
| InChIKey | YIZPWUCBODRKON-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|