About 7-bromo-1,2,3,4-tetrahydroisoquinolin-5-ol
7-bromo-1,2,3,4-tetrahydroisoquinolin-5-ol (PubChem CID 84691706) has the molecular formula C9H10BrNO
and a molecular weight of 228.09 g/mol. Its IUPAC name is 7-bromo-1,2,3,4-tetrahydroisoquinolin-5-ol.
Molecular Properties
| Compound Name | 7-bromo-1,2,3,4-tetrahydroisoquinolin-5-ol |
| PubChem CID | 84691706 |
| Molecular Formula | C9H10BrNO |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 7-bromo-1,2,3,4-tetrahydroisoquinolin-5-ol |
| SMILES | Oc1cc(Br)cc2c1CCNC2 |
| InChI | InChI=1S/C9H10BrNO/c10-7-3-6-5-11-2-1-8(6)9(12)4-7/h3-4,11-12H,1-2,5H2 |
| InChIKey | QAICYQFJGYEBLI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-1,2,3,4-tetrahydroisoquinolin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1,2,3,4-tetrahydroisoquinolin-5-ol?
The IUPAC name of 7-bromo-1,2,3,4-tetrahydroisoquinolin-5-ol (CID 84691706) is 7-bromo-1,2,3,4-tetrahydroisoquinolin-5-ol.
What is the SMILES notation for 7-bromo-1,2,3,4-tetrahydroisoquinolin-5-ol?
The canonical SMILES for 7-bromo-1,2,3,4-tetrahydroisoquinolin-5-ol is Oc1cc(Br)cc2c1CCNC2.
What is the InChIKey of 7-bromo-1,2,3,4-tetrahydroisoquinolin-5-ol?
The InChIKey is QAICYQFJGYEBLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO/c10-7-3-6-5-11-2-1-8(6)9(12)4-7/h3-4,11-12H,1-2,5H2.
What are the key properties of 7-bromo-1,2,3,4-tetrahydroisoquinolin-5-ol?
7-bromo-1,2,3,4-tetrahydroisoquinolin-5-ol has a molecular weight of 228.09 g/mol, XLogP of 1.80, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1,2,3,4-tetrahydroisoquinolin-5-ol is sourced from PubChem (CID 84691706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).