C11H13ClO3 — CID 84692201
5-chloro-6-propan-2-yl-2,3-dihydro-1,4-benzodioxin-7-ol (PubChem CID 84692201) has the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. Its IUPAC name is 5-chloro-6-propan-2-yl-2,3-dihydro-1,4-benzodioxin-7-ol.
| Compound Name | 5-chloro-6-propan-2-yl-2,3-dihydro-1,4-benzodioxin-7-ol |
|---|---|
| PubChem CID | 84692201 |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 5-chloro-6-propan-2-yl-2,3-dihydro-1,4-benzodioxin-7-ol |
| SMILES | CC(C)c1c(O)cc2c(c1Cl)OCCO2 |
| InChI | InChI=1S/C11H13ClO3/c1-6(2)9-7(13)5-8-11(10(9)12)15-4-3-14-8/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | YREADEMVPRERSR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |