C11H13F2NO2 — CID 84692542
2-amino-1-[2-(1,1-difluoroethyl)-3-methoxyphenyl]ethanone (PubChem CID 84692542) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-amino-1-[2-(1,1-difluoroethyl)-3-methoxyphenyl]ethanone.
| Compound Name | 2-amino-1-[2-(1,1-difluoroethyl)-3-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 84692542 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-amino-1-[2-(1,1-difluoroethyl)-3-methoxyphenyl]ethanone |
| SMILES | COc1cccc(C(=O)CN)c1C(C)(F)F |
| InChI | InChI=1S/C11H13F2NO2/c1-11(12,13)10-7(8(15)6-14)4-3-5-9(10)16-2/h3-5H,6,14H2,1-2H3 |
| InChIKey | FYMGFMKUZNGBDF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |